C11H13BrF10O3 — CID 86753506
1-bromo-5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]ethoxy]pentane (PubChem CID 86753506) has the molecular formula C11H13BrF10O3 and a molecular weight of 463.11 g/mol. Its IUPAC name is 1-bromo-5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]ethoxy]pentane.
| Compound Name | 1-bromo-5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]ethoxy]pentane |
|---|---|
| PubChem CID | 86753506 |
| Molecular Formula | C11H13BrF10O3 |
| Molecular Weight | 463.11 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 1-bromo-5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]ethoxy]pentane |
| SMILES | FC(OC(F)(F)C(F)(F)OC(F)(F)COCCCCCBr)C(F)(F)F |
| InChI | InChI=1S/C11H13BrF10O3/c12-4-2-1-3-5-23-6-8(14,15)25-11(21,22)10(19,20)24-7(13)9(16,17)18/h7H,1-6H2 |
| InChIKey | MHDGWGLXFILRGI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.11 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|