C28H34F10N2O5 — CID 86753505
2-[4-[5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]ethoxy]pentoxy]phenyl]-5-heptoxypyrimidine (PubChem CID 86753505) has the molecular formula C28H34F10N2O5 and a molecular weight of 668.57 g/mol. Its IUPAC name is 2-[4-[5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]ethoxy]pentoxy]phenyl]-5-heptoxypyrimidine.
| Compound Name | 2-[4-[5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]ethoxy]pentoxy]phenyl]-5-heptoxypyrimidine |
|---|---|
| PubChem CID | 86753505 |
| Molecular Formula | C28H34F10N2O5 |
| Molecular Weight | 668.57 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | 2-[4-[5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]ethoxy]pentoxy]phenyl]-5-heptoxypyrimidine |
| SMILES | CCCCCCCOc1cnc(-c2ccc(OCCCCCOCC(F)(F)OC(F)(F)C(F)(F)OC(F)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C28H34F10N2O5/c1-2-3-4-5-8-16-43-22-17-39-23(40-18-22)20-10-12-21(13-11-20)42-15-9-6-7-14-41-19-25(30,31)45-28(37,38)27(35,36)44-24(29)26(32,33)34/h10-13,17-18,24H,2-9,14-16,19H2,1H3 |
| InChIKey | HQHBOZPTBYZXFB-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.57 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|