C30H33F15N2O3 — CID 54333541
2-[4-[6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hexyl]phenyl]-5-hexylpyrimidine (PubChem CID 54333541) has the molecular formula C30H33F15N2O3 and a molecular weight of 754.58 g/mol. Its IUPAC name is 2-[4-[6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hexyl]phenyl]-5-hexylpyrimidine.
| Compound Name | 2-[4-[6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hexyl]phenyl]-5-hexylpyrimidine |
|---|---|
| PubChem CID | 54333541 |
| Molecular Formula | C30H33F15N2O3 |
| Molecular Weight | 754.58 g/mol |
| Exact Mass | 754.23 |
| IUPAC Name | 2-[4-[6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hexyl]phenyl]-5-hexylpyrimidine |
| SMILES | CCCCCCc1cnc(-c2ccc(CCCCCCOCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C30H33F15N2O3/c1-2-3-4-7-11-21-17-46-23(47-18-21)22-14-12-20(13-15-22)10-8-5-6-9-16-48-19-24(31,32)49-29(42,43)30(44,45)50-28(40,41)26(35,36)25(33,34)27(37,38)39/h12-15,17-18H,2-11,16,19H2,1H3 |
| InChIKey | SZZZISJLQFRAQX-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.58 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|