C28H30F14N2O5 — CID 22880426
2-[4-[(2R)-3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]-2-fluoropropoxy]phenyl]-5-octylpyrimidine (PubChem CID 22880426) has the molecular formula C28H30F14N2O5 and a molecular weight of 740.53 g/mol. Its IUPAC name is 2-[4-[(2R)-3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]-2-fluoropropoxy]phenyl]-5-octylpyrimidine.
| Compound Name | 2-[4-[(2R)-3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]-2-fluoropropoxy]phenyl]-5-octylpyrimidine |
|---|---|
| PubChem CID | 22880426 |
| Molecular Formula | C28H30F14N2O5 |
| Molecular Weight | 740.53 g/mol |
| Exact Mass | 740.19 |
| IUPAC Name | 2-[4-[(2R)-3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]-2-fluoropropoxy]phenyl]-5-octylpyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC[C@H](F)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C28H30F14N2O5/c1-2-3-4-5-6-7-8-18-13-43-22(44-14-18)19-9-11-21(12-10-19)46-16-20(29)15-45-17-23(30,31)47-24(32,33)25(34,35)48-26(36,37)27(38,39)49-28(40,41)42/h9-14,20H,2-8,15-17H2,1H3/t20-/m1/s1 |
| InChIKey | HFDFXHKKARKYTC-HXUWFJFHSA-N |
| XLogP | 9.31 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.53 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|