C27H40F2N2O — CID 18697305
5-decyl-2-[4-(2,5-difluoroheptoxy)phenyl]pyrimidine (PubChem CID 18697305) has the molecular formula C27H40F2N2O and a molecular weight of 446.63 g/mol. Its IUPAC name is 5-decyl-2-[4-(2,5-difluoroheptoxy)phenyl]pyrimidine.
| Compound Name | 5-decyl-2-[4-(2,5-difluoroheptoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 18697305 |
| Molecular Formula | C27H40F2N2O |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | 5-decyl-2-[4-(2,5-difluoroheptoxy)phenyl]pyrimidine |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(OCC(F)CCC(F)CC)cc2)nc1 |
| InChI | InChI=1S/C27H40F2N2O/c1-3-5-6-7-8-9-10-11-12-22-19-30-27(31-20-22)23-13-17-26(18-14-23)32-21-25(29)16-15-24(28)4-2/h13-14,17-20,24-25H,3-12,15-16,21H2,1-2H3 |
| InChIKey | KWUOLFGXZHKOOO-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|