C29H45FN2O — CID 15476090
5-decyl-2-[4-[(2S,6S)-2-fluoro-6-methyloctoxy]phenyl]pyrimidine (PubChem CID 15476090) has the molecular formula C29H45FN2O and a molecular weight of 456.69 g/mol. Its IUPAC name is 5-decyl-2-[4-[(2S,6S)-2-fluoro-6-methyloctoxy]phenyl]pyrimidine.
| Compound Name | 5-decyl-2-[4-[(2S,6S)-2-fluoro-6-methyloctoxy]phenyl]pyrimidine |
|---|---|
| PubChem CID | 15476090 |
| Molecular Formula | C29H45FN2O |
| Molecular Weight | 456.69 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | 5-decyl-2-[4-[(2S,6S)-2-fluoro-6-methyloctoxy]phenyl]pyrimidine |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(OC[C@@H](F)CCC[C@@H](C)CC)cc2)nc1 |
| InChI | InChI=1S/C29H45FN2O/c1-4-6-7-8-9-10-11-12-15-25-21-31-29(32-22-25)26-17-19-28(20-18-26)33-23-27(30)16-13-14-24(3)5-2/h17-22,24,27H,4-16,23H2,1-3H3/t24-,27-/m0/s1 |
| InChIKey | BDYXKWCXKFBMDK-IGKIAQTJSA-N |
| XLogP | 8.76 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.69 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|