C25H36F2N2O — CID 18697036
2-[4-(2,5-difluoroheptoxy)phenyl]-5-octylpyrimidine (PubChem CID 18697036) has the molecular formula C25H36F2N2O and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[4-(2,5-difluoroheptoxy)phenyl]-5-octylpyrimidine.
| Compound Name | 2-[4-(2,5-difluoroheptoxy)phenyl]-5-octylpyrimidine |
|---|---|
| PubChem CID | 18697036 |
| Molecular Formula | C25H36F2N2O |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 2-[4-(2,5-difluoroheptoxy)phenyl]-5-octylpyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OCC(F)CCC(F)CC)cc2)nc1 |
| InChI | InChI=1S/C25H36F2N2O/c1-3-5-6-7-8-9-10-20-17-28-25(29-18-20)21-11-15-24(16-12-21)30-19-23(27)14-13-22(26)4-2/h11-12,15-18,22-23H,3-10,13-14,19H2,1-2H3 |
| InChIKey | JRHBOSZSRHRCOP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|