C13H9F19O7S — CID 175708911
3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]ethoxy]propane-1-sulfonic acid (PubChem CID 175708911) has the molecular formula C13H9F19O7S and a molecular weight of 670.24 g/mol. Its IUPAC name is 3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]ethoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]ethoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175708911 |
| Molecular Formula | C13H9F19O7S |
| Molecular Weight | 670.24 g/mol |
| Exact Mass | 669.98 |
| IUPAC Name | 3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]ethoxy]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCOCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F19O7S/c14-5(15,4-36-2-1-3-40(33,34)35)37-10(25,26)11(27,28)39-13(31,32)12(29,30)38-9(23,24)7(18,19)6(16,17)8(20,21)22/h1-4H2,(H,33,34,35) |
| InChIKey | DDMXPENKUCKTGS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.24 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|