C9H5F13O4 — CID 118909864
1-(2-ethenoxy-1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethane (PubChem CID 118909864) has the molecular formula C9H5F13O4 and a molecular weight of 424.11 g/mol. Its IUPAC name is 1-(2-ethenoxy-1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethane.
| Compound Name | 1-(2-ethenoxy-1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethane |
|---|---|
| PubChem CID | 118909864 |
| Molecular Formula | C9H5F13O4 |
| Molecular Weight | 424.11 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 1-(2-ethenoxy-1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethane |
| SMILES | C=COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C9H5F13O4/c1-2-23-3-4(10,11)24-5(12,13)6(14,15)25-7(16,17)8(18,19)26-9(20,21)22/h2H,1,3H2 |
| InChIKey | SRXPICWZKBSCJQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.11 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|