C7H5F9O — CID 57443666
5-ethenoxy-1,1,1,2,2,3,3,4,4-nonafluoropentane (PubChem CID 57443666) has the molecular formula C7H5F9O and a molecular weight of 276.10 g/mol. Its IUPAC name is 5-ethenoxy-1,1,1,2,2,3,3,4,4-nonafluoropentane.
| Compound Name | 5-ethenoxy-1,1,1,2,2,3,3,4,4-nonafluoropentane |
|---|---|
| PubChem CID | 57443666 |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 5-ethenoxy-1,1,1,2,2,3,3,4,4-nonafluoropentane |
| SMILES | C=COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O/c1-2-17-3-4(8,9)5(10,11)6(12,13)7(14,15)16/h2H,1,3H2 |
| InChIKey | IGGHZRYCVCUNBN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|