C16H17F17O2Si — CID 102274060
2-ethenoxyethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-dimethylsilane (PubChem CID 102274060) has the molecular formula C16H17F17O2Si and a molecular weight of 592.36 g/mol. Its IUPAC name is 2-ethenoxyethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-dimethylsilane.
| Compound Name | 2-ethenoxyethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-dimethylsilane |
|---|---|
| PubChem CID | 102274060 |
| Molecular Formula | C16H17F17O2Si |
| Molecular Weight | 592.36 g/mol |
| Exact Mass | 592.07 |
| IUPAC Name | 2-ethenoxyethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-dimethylsilane |
| SMILES | C=COCCO[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F17O2Si/c1-4-34-6-7-35-36(2,3)8-5-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h4H,1,5-8H2,2-3H3 |
| InChIKey | SZCFPCUPDDNKFY-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.36 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|