C17H24F12O9S — CID 90068336
2-[2-[2-[2-[2-[2-[2-[1,1-difluoro-2-(sulfanylmethoxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 90068336) has the molecular formula C17H24F12O9S and a molecular weight of 632.41 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[1,1-difluoro-2-(sulfanylmethoxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[1,1-difluoro-2-(sulfanylmethoxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 90068336 |
| Molecular Formula | C17H24F12O9S |
| Molecular Weight | 632.41 g/mol |
| Exact Mass | 632.09 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[1,1-difluoro-2-(sulfanylmethoxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOCCOCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)COCS |
| InChI | InChI=1S/C17H24F12O9S/c18-12(19,9-34-8-7-33-6-5-32-4-3-31-2-1-30)36-14(22,23)16(26,27)38-17(28,29)15(24,25)37-13(20,21)10-35-11-39/h30,39H,1-11H2 |
| InChIKey | CJWKEAYOQDVXGS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|