C14H18F12O6 — CID 102226028
2-[2-[1,1,1,4,4,4-hexafluoro-3-[2-(2-hydroxyethoxy)ethoxy]-2,3-bis(trifluoromethyl)butan-2-yl]oxyethoxy]ethanol (PubChem CID 102226028) has the molecular formula C14H18F12O6 and a molecular weight of 510.27 g/mol. Its IUPAC name is 2-[2-[1,1,1,4,4,4-hexafluoro-3-[2-(2-hydroxyethoxy)ethoxy]-2,3-bis(trifluoromethyl)butan-2-yl]oxyethoxy]ethanol.
| Compound Name | 2-[2-[1,1,1,4,4,4-hexafluoro-3-[2-(2-hydroxyethoxy)ethoxy]-2,3-bis(trifluoromethyl)butan-2-yl]oxyethoxy]ethanol |
|---|---|
| PubChem CID | 102226028 |
| Molecular Formula | C14H18F12O6 |
| Molecular Weight | 510.27 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 2-[2-[1,1,1,4,4,4-hexafluoro-3-[2-(2-hydroxyethoxy)ethoxy]-2,3-bis(trifluoromethyl)butan-2-yl]oxyethoxy]ethanol |
| SMILES | OCCOCCOC(C(F)(F)F)(C(F)(F)F)C(OCCOCCO)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H18F12O6/c15-11(16,17)9(12(18,19)20,31-7-5-29-3-1-27)10(13(21,22)23,14(24,25)26)32-8-6-30-4-2-28/h27-28H,1-8H2 |
| InChIKey | IZDNPSPBXWTDCT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|