C15H29F3O8 — CID 87962510
2-[2-[2-[2-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 87962510) has the molecular formula C15H29F3O8 and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 87962510 |
| Molecular Formula | C15H29F3O8 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOCCOCCOCCOCCOC(F)(F)F |
| InChI | InChI=1S/C15H29F3O8/c16-15(17,18)26-14-13-25-12-11-24-10-9-23-8-7-22-6-5-21-4-3-20-2-1-19/h19H,1-14H2 |
| InChIKey | LXZYNBSGCSIVJW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|