C19H17F15O4 — CID 54014225
(2R)-1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-5-phenylpentan-2-ol (PubChem CID 54014225) has the molecular formula C19H17F15O4 and a molecular weight of 594.31 g/mol. Its IUPAC name is (2R)-1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-5-phenylpentan-2-ol.
| Compound Name | (2R)-1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-5-phenylpentan-2-ol |
|---|---|
| PubChem CID | 54014225 |
| Molecular Formula | C19H17F15O4 |
| Molecular Weight | 594.31 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | (2R)-1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-5-phenylpentan-2-ol |
| SMILES | O[C@H](CCCc1ccccc1)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H17F15O4/c20-13(21,10-36-9-12(35)8-4-7-11-5-2-1-3-6-11)37-18(31,32)19(33,34)38-17(29,30)15(24,25)14(22,23)16(26,27)28/h1-3,5-6,12,35H,4,7-10H2/t12-/m1/s1 |
| InChIKey | KUMRFDWSJQRYPM-GFCCVEGCSA-N |
| XLogP | 6.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.31 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|