C18H15F15O — CID 162347931
6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentadecafluoro-1-phenyldodecan-4-ol (PubChem CID 162347931) has the molecular formula C18H15F15O and a molecular weight of 532.29 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentadecafluoro-1-phenyldodecan-4-ol.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentadecafluoro-1-phenyldodecan-4-ol |
|---|---|
| PubChem CID | 162347931 |
| Molecular Formula | C18H15F15O |
| Molecular Weight | 532.29 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentadecafluoro-1-phenyldodecan-4-ol |
| SMILES | OC(CCCc1ccccc1)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H15F15O/c19-12(20,9-11(34)8-4-7-10-5-2-1-3-6-10)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)33/h1-3,5-6,11,34H,4,7-9H2 |
| InChIKey | MQGNJSOVYPFZFP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.29 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|