C14H14F9NO — CID 98082111
(2R)-1-(benzylamino)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol (PubChem CID 98082111) has the molecular formula C14H14F9NO and a molecular weight of 383.25 g/mol. Its IUPAC name is (2R)-1-(benzylamino)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol.
| Compound Name | (2R)-1-(benzylamino)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol |
|---|---|
| PubChem CID | 98082111 |
| Molecular Formula | C14H14F9NO |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (2R)-1-(benzylamino)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol |
| SMILES | O[C@@H](CNCc1ccccc1)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H14F9NO/c15-11(16,12(17,18)13(19,20)14(21,22)23)6-10(25)8-24-7-9-4-2-1-3-5-9/h1-5,10,24-25H,6-8H2/t10-/m1/s1 |
| InChIKey | LTRNBXMYHOAEBK-SNVBAGLBSA-N |
| XLogP | 4.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|