C17H18F11NO2 — CID 98082100
(2S)-1-(benzylamino)-3-(2,2,3,3,4,4,5,5,6,6,7-undecafluoroheptoxy)propan-2-ol (PubChem CID 98082100) has the molecular formula C17H18F11NO2 and a molecular weight of 477.31 g/mol. Its IUPAC name is (2S)-1-(benzylamino)-3-(2,2,3,3,4,4,5,5,6,6,7-undecafluoroheptoxy)propan-2-ol.
| Compound Name | (2S)-1-(benzylamino)-3-(2,2,3,3,4,4,5,5,6,6,7-undecafluoroheptoxy)propan-2-ol |
|---|---|
| PubChem CID | 98082100 |
| Molecular Formula | C17H18F11NO2 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (2S)-1-(benzylamino)-3-(2,2,3,3,4,4,5,5,6,6,7-undecafluoroheptoxy)propan-2-ol |
| SMILES | O[C@@H](CNCc1ccccc1)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C17H18F11NO2/c18-9-13(19,20)15(23,24)17(27,28)16(25,26)14(21,22)10-31-8-12(30)7-29-6-11-4-2-1-3-5-11/h1-5,12,29-30H,6-10H2/t12-/m0/s1 |
| InChIKey | IMAXLOATSYHDEV-LBPRGKRZSA-N |
| XLogP | 4.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|