C20H14F21NO — CID 99649617
(2S)-1-(benzylamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecan-2-ol (PubChem CID 99649617) has the molecular formula C20H14F21NO and a molecular weight of 683.30 g/mol. Its IUPAC name is (2S)-1-(benzylamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecan-2-ol.
| Compound Name | (2S)-1-(benzylamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecan-2-ol |
|---|---|
| PubChem CID | 99649617 |
| Molecular Formula | C20H14F21NO |
| Molecular Weight | 683.30 g/mol |
| Exact Mass | 683.07 |
| IUPAC Name | (2S)-1-(benzylamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecan-2-ol |
| SMILES | O[C@H](CNCc1ccccc1)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H14F21NO/c21-11(22,6-10(43)8-42-7-9-4-2-1-3-5-9)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)17(33,34)18(35,36)19(37,38)20(39,40)41/h1-5,10,42-43H,6-8H2/t10-/m0/s1 |
| InChIKey | XNKAFQHJWDSXQT-JTQLQIEISA-N |
| XLogP | 7.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.30 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|