C15H17F8NO2 — CID 98082099
(2R)-1-(benzylamino)-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol (PubChem CID 98082099) has the molecular formula C15H17F8NO2 and a molecular weight of 395.29 g/mol. Its IUPAC name is (2R)-1-(benzylamino)-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol.
| Compound Name | (2R)-1-(benzylamino)-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol |
|---|---|
| PubChem CID | 98082099 |
| Molecular Formula | C15H17F8NO2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (2R)-1-(benzylamino)-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol |
| SMILES | O[C@H](CNCc1ccccc1)COCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H17F8NO2/c16-12(17)14(20,21)15(22,23)13(18,19)9-26-8-11(25)7-24-6-10-4-2-1-3-5-10/h1-5,11-12,24-25H,6-9H2/t11-/m1/s1 |
| InChIKey | JCPBHMJKUXYFQE-LLVKDONJSA-N |
| XLogP | 3.32 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|