C8H15F6NO6S2Si — CID 175909763
N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 175909763) has the molecular formula C8H15F6NO6S2Si and a molecular weight of 427.42 g/mol. Its IUPAC name is N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 175909763 |
| Molecular Formula | C8H15F6NO6S2Si |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCO[SiH](OCCC)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H15F6NO6S2Si/c1-3-5-20-24(21-6-4-2)15(22(16,17)7(9,10)11)23(18,19)8(12,13)14/h24H,3-6H2,1-2H3 |
| InChIKey | KSVGYHLDOFSYDL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|