About N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide
N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 175909763) has the molecular formula C8H15F6NO6S2Si
and a molecular weight of 427.42 g/mol. Its IUPAC name is N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| PubChem CID | 175909763 |
| Molecular Formula | C8H15F6NO6S2Si |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCO[SiH](OCCC)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H15F6NO6S2Si/c1-3-5-20-24(21-6-4-2)15(22(16,17)7(9,10)11)23(18,19)8(12,13)14/h24H,3-6H2,1-2H3 |
| InChIKey | KSVGYHLDOFSYDL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The IUPAC name of N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (CID 175909763) is N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
What is the SMILES notation for N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The canonical SMILES for N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide is CCCO[SiH](OCCC)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The InChIKey is KSVGYHLDOFSYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F6NO6S2Si/c1-3-5-20-24(21-6-4-2)15(22(16,17)7(9,10)11)23(18,19)8(12,13)14/h24H,3-6H2,1-2H3.
What are the key properties of N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide has a molecular weight of 427.42 g/mol, XLogP of 1.56, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-dipropoxysilyl-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide is sourced from PubChem (CID 175909763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).