C14H27F4NO3S — CID 58436031
1-(difluoromethoxy)-1,1-difluoro-N,N-dihexylmethanesulfonamide (PubChem CID 58436031) has the molecular formula C14H27F4NO3S and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-(difluoromethoxy)-1,1-difluoro-N,N-dihexylmethanesulfonamide.
| Compound Name | 1-(difluoromethoxy)-1,1-difluoro-N,N-dihexylmethanesulfonamide |
|---|---|
| PubChem CID | 58436031 |
| Molecular Formula | C14H27F4NO3S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-(difluoromethoxy)-1,1-difluoro-N,N-dihexylmethanesulfonamide |
| SMILES | CCCCCCN(CCCCCC)S(=O)(=O)C(F)(F)OC(F)F |
| InChI | InChI=1S/C14H27F4NO3S/c1-3-5-7-9-11-19(12-10-8-6-4-2)23(20,21)14(17,18)22-13(15)16/h13H,3-12H2,1-2H3 |
| InChIKey | UDZBAQDQAATMPW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|