C8H7F4NO4S2 — CID 59403785
N-benzyl-N-(trifluoromethylsulfonyl)sulfamoyl fluoride (PubChem CID 59403785) has the molecular formula C8H7F4NO4S2 and a molecular weight of 321.27 g/mol. Its IUPAC name is N-benzyl-N-(trifluoromethylsulfonyl)sulfamoyl fluoride.
| Compound Name | N-benzyl-N-(trifluoromethylsulfonyl)sulfamoyl fluoride |
|---|---|
| PubChem CID | 59403785 |
| Molecular Formula | C8H7F4NO4S2 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | N-benzyl-N-(trifluoromethylsulfonyl)sulfamoyl fluoride |
| SMILES | O=S(=O)(F)N(Cc1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H7F4NO4S2/c9-8(10,11)18(14,15)13(19(12,16)17)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | GVDWFVIDVSLUFR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |