C8H9F6N3O4S2 — CID 159794587
hydrazine;1,1,1-trifluoro-N-phenyl-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 159794587) has the molecular formula C8H9F6N3O4S2 and a molecular weight of 389.30 g/mol. Its IUPAC name is hydrazine;1,1,1-trifluoro-N-phenyl-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | hydrazine;1,1,1-trifluoro-N-phenyl-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 159794587 |
| Molecular Formula | C8H9F6N3O4S2 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | hydrazine;1,1,1-trifluoro-N-phenyl-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | NN.O=S(=O)(N(c1ccccc1)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H5F6NO4S2.H4N2/c9-7(10,11)20(16,17)15(6-4-2-1-3-5-6)21(18,19)8(12,13)14;1-2/h1-5H;1-2H2 |
| InChIKey | NIZTXMIWJAKSOA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|