C11H15F3NO5PS — CID 10498785
N-diethoxyphosphoryl-1,1,1-trifluoro-N-phenylmethanesulfonamide (PubChem CID 10498785) has the molecular formula C11H15F3NO5PS and a molecular weight of 361.28 g/mol. Its IUPAC name is N-diethoxyphosphoryl-1,1,1-trifluoro-N-phenylmethanesulfonamide.
| Compound Name | N-diethoxyphosphoryl-1,1,1-trifluoro-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 10498785 |
| Molecular Formula | C11H15F3NO5PS |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-diethoxyphosphoryl-1,1,1-trifluoro-N-phenylmethanesulfonamide |
| SMILES | CCOP(=O)(OCC)N(c1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F3NO5PS/c1-3-19-21(16,20-4-2)15(10-8-6-5-7-9-10)22(17,18)11(12,13)14/h5-9H,3-4H2,1-2H3 |
| InChIKey | YEWKGLUHESPIGI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|