C12H15Cl3NO5PS — CID 11247240
N-diethoxyphosphoryl-N-(1,2,2-trichloroethenyl)benzenesulfonamide (PubChem CID 11247240) has the molecular formula C12H15Cl3NO5PS and a molecular weight of 422.65 g/mol. Its IUPAC name is N-diethoxyphosphoryl-N-(1,2,2-trichloroethenyl)benzenesulfonamide.
| Compound Name | N-diethoxyphosphoryl-N-(1,2,2-trichloroethenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11247240 |
| Molecular Formula | C12H15Cl3NO5PS |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 420.95 |
| IUPAC Name | N-diethoxyphosphoryl-N-(1,2,2-trichloroethenyl)benzenesulfonamide |
| SMILES | CCOP(=O)(OCC)N(C(Cl)=C(Cl)Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15Cl3NO5PS/c1-3-20-22(17,21-4-2)16(12(15)11(13)14)23(18,19)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | DRSQGRYWBIEJPN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|