C12H16Cl3O6PS — CID 4065494
(2,2,2-trichloro-1-diethoxyphosphorylethyl) benzenesulfonate (PubChem CID 4065494) has the molecular formula C12H16Cl3O6PS and a molecular weight of 425.65 g/mol. Its IUPAC name is (2,2,2-trichloro-1-diethoxyphosphorylethyl) benzenesulfonate.
| Compound Name | (2,2,2-trichloro-1-diethoxyphosphorylethyl) benzenesulfonate |
|---|---|
| PubChem CID | 4065494 |
| Molecular Formula | C12H16Cl3O6PS |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | (2,2,2-trichloro-1-diethoxyphosphorylethyl) benzenesulfonate |
| SMILES | CCOP(=O)(OCC)C(OS(=O)(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H16Cl3O6PS/c1-3-19-22(16,20-4-2)11(12(13,14)15)21-23(17,18)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| InChIKey | ZUXILRATYSPPJI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|