C21H20O9S3 — CID 170551829
1,1-bis(benzenesulfonyloxy)propyl benzenesulfonate (PubChem CID 170551829) has the molecular formula C21H20O9S3 and a molecular weight of 512.58 g/mol. Its IUPAC name is 1,1-bis(benzenesulfonyloxy)propyl benzenesulfonate.
| Compound Name | 1,1-bis(benzenesulfonyloxy)propyl benzenesulfonate |
|---|---|
| PubChem CID | 170551829 |
| Molecular Formula | C21H20O9S3 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | 1,1-bis(benzenesulfonyloxy)propyl benzenesulfonate |
| SMILES | CCC(OS(=O)(=O)c1ccccc1)(OS(=O)(=O)c1ccccc1)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O9S3/c1-2-21(28-31(22,23)18-12-6-3-7-13-18,29-32(24,25)19-14-8-4-9-15-19)30-33(26,27)20-16-10-5-11-17-20/h3-17H,2H2,1H3 |
| InChIKey | BANLUFGXYBUDQC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|