C10H11F4O2P — CID 66797107
1-[ethoxy(2,2,2-trifluoroethyl)phosphoryl]-2-fluorobenzene (PubChem CID 66797107) has the molecular formula C10H11F4O2P and a molecular weight of 270.16 g/mol. Its IUPAC name is 1-[ethoxy(2,2,2-trifluoroethyl)phosphoryl]-2-fluorobenzene.
| Compound Name | 1-[ethoxy(2,2,2-trifluoroethyl)phosphoryl]-2-fluorobenzene |
|---|---|
| PubChem CID | 66797107 |
| Molecular Formula | C10H11F4O2P |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1-[ethoxy(2,2,2-trifluoroethyl)phosphoryl]-2-fluorobenzene |
| SMILES | CCOP(=O)(CC(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C10H11F4O2P/c1-2-16-17(15,7-10(12,13)14)9-6-4-3-5-8(9)11/h3-6H,2,7H2,1H3 |
| InChIKey | KBYKCOWMKLMIDO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|