C12H18F2NO3P — CID 124518457
(1S)-2-diethoxyphosphoryl-2,2-difluoro-1-phenylethanamine (PubChem CID 124518457) has the molecular formula C12H18F2NO3P and a molecular weight of 293.25 g/mol. Its IUPAC name is (1S)-2-diethoxyphosphoryl-2,2-difluoro-1-phenylethanamine.
| Compound Name | (1S)-2-diethoxyphosphoryl-2,2-difluoro-1-phenylethanamine |
|---|---|
| PubChem CID | 124518457 |
| Molecular Formula | C12H18F2NO3P |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (1S)-2-diethoxyphosphoryl-2,2-difluoro-1-phenylethanamine |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C12H18F2NO3P/c1-3-17-19(16,18-4-2)12(13,14)11(15)10-8-6-5-7-9-10/h5-9,11H,3-4,15H2,1-2H3/t11-/m0/s1 |
| InChIKey | VOMXDASMZHCKAZ-NSHDSACASA-N |
| XLogP | 3.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|