C15H22F2NO4PS — CID 101182631
2-diethoxyphosphoryl-2,2-difluoro-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]ethanethioamide (PubChem CID 101182631) has the molecular formula C15H22F2NO4PS and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-2,2-difluoro-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]ethanethioamide.
| Compound Name | 2-diethoxyphosphoryl-2,2-difluoro-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]ethanethioamide |
|---|---|
| PubChem CID | 101182631 |
| Molecular Formula | C15H22F2NO4PS |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-diethoxyphosphoryl-2,2-difluoro-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]ethanethioamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(=S)N[C@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H22F2NO4PS/c1-4-21-23(20,22-5-2)15(16,17)14(24)18-11(3)13(19)12-9-7-6-8-10-12/h6-11,13,19H,4-5H2,1-3H3,(H,18,24)/t11-,13-/m1/s1 |
| InChIKey | HSMAEOWVRUPQJH-DGCLKSJQSA-N |
| XLogP | 3.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|