C13H19F2O5PS — CID 15305264
(3-diethoxyphosphoryl-3,3-difluoropropyl)sulfonylbenzene (PubChem CID 15305264) has the molecular formula C13H19F2O5PS and a molecular weight of 356.33 g/mol. Its IUPAC name is (3-diethoxyphosphoryl-3,3-difluoropropyl)sulfonylbenzene.
| Compound Name | (3-diethoxyphosphoryl-3,3-difluoropropyl)sulfonylbenzene |
|---|---|
| PubChem CID | 15305264 |
| Molecular Formula | C13H19F2O5PS |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (3-diethoxyphosphoryl-3,3-difluoropropyl)sulfonylbenzene |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19F2O5PS/c1-3-19-21(16,20-4-2)13(14,15)10-11-22(17,18)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | NLFVWTVYWYQTRF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|