C15H22FO6PS — CID 71696960
5-(benzenesulfonyl)-5-diethoxyphosphoryl-5-fluoropentan-2-one (PubChem CID 71696960) has the molecular formula C15H22FO6PS and a molecular weight of 380.37 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-5-diethoxyphosphoryl-5-fluoropentan-2-one.
| Compound Name | 5-(benzenesulfonyl)-5-diethoxyphosphoryl-5-fluoropentan-2-one |
|---|---|
| PubChem CID | 71696960 |
| Molecular Formula | C15H22FO6PS |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 5-(benzenesulfonyl)-5-diethoxyphosphoryl-5-fluoropentan-2-one |
| SMILES | CCOP(=O)(OCC)C(F)(CCC(C)=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22FO6PS/c1-4-21-23(18,22-5-2)15(16,12-11-13(3)17)24(19,20)14-9-7-6-8-10-14/h6-10H,4-5,11-12H2,1-3H3 |
| InChIKey | XVOFTNDTVJXVMU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|