C15H17F6O7PS — CID 134878587
[diethoxyphosphorylmethyl-phenyl-(2,2,2-trifluoroacetyl)oxy-λ4-sulfanyl] 2,2,2-trifluoroacetate (PubChem CID 134878587) has the molecular formula C15H17F6O7PS and a molecular weight of 486.32 g/mol. Its IUPAC name is [diethoxyphosphorylmethyl-phenyl-(2,2,2-trifluoroacetyl)oxy-λ4-sulfanyl] 2,2,2-trifluoroacetate.
| Compound Name | [diethoxyphosphorylmethyl-phenyl-(2,2,2-trifluoroacetyl)oxy-λ4-sulfanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134878587 |
| Molecular Formula | C15H17F6O7PS |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | [diethoxyphosphorylmethyl-phenyl-(2,2,2-trifluoroacetyl)oxy-λ4-sulfanyl] 2,2,2-trifluoroacetate |
| SMILES | CCOP(=O)(CS(OC(=O)C(F)(F)F)(OC(=O)C(F)(F)F)c1ccccc1)OCC |
| InChI | InChI=1S/C15H17F6O7PS/c1-3-25-29(24,26-4-2)10-30(11-8-6-5-7-9-11,27-12(22)14(16,17)18)28-13(23)15(19,20)21/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | OWNDLULJVABGAA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|