C20H26FO8P — CID 10343405
diethyl 2-diethoxyphosphoryl-2-fluoro-3-hydroxy-3-(2-phenylethynyl)butanedioate (PubChem CID 10343405) has the molecular formula C20H26FO8P and a molecular weight of 444.39 g/mol. Its IUPAC name is diethyl 2-diethoxyphosphoryl-2-fluoro-3-hydroxy-3-(2-phenylethynyl)butanedioate.
| Compound Name | diethyl 2-diethoxyphosphoryl-2-fluoro-3-hydroxy-3-(2-phenylethynyl)butanedioate |
|---|---|
| PubChem CID | 10343405 |
| Molecular Formula | C20H26FO8P |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | diethyl 2-diethoxyphosphoryl-2-fluoro-3-hydroxy-3-(2-phenylethynyl)butanedioate |
| SMILES | CCOC(=O)C(O)(C#Cc1ccccc1)C(F)(C(=O)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C20H26FO8P/c1-5-26-17(22)19(24,15-14-16-12-10-9-11-13-16)20(21,18(23)27-6-2)30(25,28-7-3)29-8-4/h9-13,24H,5-8H2,1-4H3 |
| InChIKey | RTBKJGPSJSJUFE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|