C22H23F3NO5P — CID 139124709
benzyl N-[(2S)-2-diethoxyphosphoryl-1,1,1-trifluoro-4-phenylbut-3-yn-2-yl]carbamate (PubChem CID 139124709) has the molecular formula C22H23F3NO5P and a molecular weight of 469.40 g/mol. Its IUPAC name is benzyl N-[(2S)-2-diethoxyphosphoryl-1,1,1-trifluoro-4-phenylbut-3-yn-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-2-diethoxyphosphoryl-1,1,1-trifluoro-4-phenylbut-3-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 139124709 |
| Molecular Formula | C22H23F3NO5P |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | benzyl N-[(2S)-2-diethoxyphosphoryl-1,1,1-trifluoro-4-phenylbut-3-yn-2-yl]carbamate |
| SMILES | CCOP(=O)(OCC)[C@](C#Cc1ccccc1)(NC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H23F3NO5P/c1-3-30-32(28,31-4-2)21(22(23,24)25,16-15-18-11-7-5-8-12-18)26-20(27)29-17-19-13-9-6-10-14-19/h5-14H,3-4,17H2,1-2H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | KINOUUKMGMWBSZ-NRFANRHFSA-N |
| XLogP | 5.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|