C16H26NO5P — CID 101460306
benzyl N-[(2R)-2-dimethoxyphosphoryl-3,3-dimethylbutan-2-yl]carbamate (PubChem CID 101460306) has the molecular formula C16H26NO5P and a molecular weight of 343.36 g/mol. Its IUPAC name is benzyl N-[(2R)-2-dimethoxyphosphoryl-3,3-dimethylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-2-dimethoxyphosphoryl-3,3-dimethylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 101460306 |
| Molecular Formula | C16H26NO5P |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | benzyl N-[(2R)-2-dimethoxyphosphoryl-3,3-dimethylbutan-2-yl]carbamate |
| SMILES | COP(=O)(OC)[C@@](C)(NC(=O)OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C16H26NO5P/c1-15(2,3)16(4,23(19,20-5)21-6)17-14(18)22-12-13-10-8-7-9-11-13/h7-11H,12H2,1-6H3,(H,17,18)/t16-/m1/s1 |
| InChIKey | LGJQPJGOMWCCQB-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|