C16H23FNO5P — CID 140874718
2-diethoxyphosphoryl-2-fluoro-N-phenylmethoxypent-4-enamide (PubChem CID 140874718) has the molecular formula C16H23FNO5P and a molecular weight of 359.33 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-2-fluoro-N-phenylmethoxypent-4-enamide.
| Compound Name | 2-diethoxyphosphoryl-2-fluoro-N-phenylmethoxypent-4-enamide |
|---|---|
| PubChem CID | 140874718 |
| Molecular Formula | C16H23FNO5P |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-diethoxyphosphoryl-2-fluoro-N-phenylmethoxypent-4-enamide |
| SMILES | C=CCC(F)(C(=O)NOCc1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H23FNO5P/c1-4-12-16(17,24(20,22-5-2)23-6-3)15(19)18-21-13-14-10-8-7-9-11-14/h4,7-11H,1,5-6,12-13H2,2-3H3,(H,18,19) |
| InChIKey | IRCHZZPHIOQJJI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|