C16H21F2O5P — CID 10690002
benzyl (E)-4-diethoxyphosphoryl-4,4-difluoro-3-methylbut-2-enoate (PubChem CID 10690002) has the molecular formula C16H21F2O5P and a molecular weight of 362.31 g/mol. Its IUPAC name is benzyl (E)-4-diethoxyphosphoryl-4,4-difluoro-3-methylbut-2-enoate.
| Compound Name | benzyl (E)-4-diethoxyphosphoryl-4,4-difluoro-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10690002 |
| Molecular Formula | C16H21F2O5P |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | benzyl (E)-4-diethoxyphosphoryl-4,4-difluoro-3-methylbut-2-enoate |
| SMILES | CCOP(=O)(OCC)C(F)(F)/C(C)=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21F2O5P/c1-4-22-24(20,23-5-2)16(17,18)13(3)11-15(19)21-12-14-9-7-6-8-10-14/h6-11H,4-5,12H2,1-3H3/b13-11+ |
| InChIKey | OZVSIZPOCYARAZ-ACCUITESSA-N |
| XLogP | 4.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|