C28H30F2NO8P — CID 57029636
dibenzyl 2-[2-(2-diethoxyphosphoryl-2,2-difluoroacetyl)pyrrol-2-yl]butanedioate (PubChem CID 57029636) has the molecular formula C28H30F2NO8P and a molecular weight of 577.52 g/mol. Its IUPAC name is dibenzyl 2-[2-(2-diethoxyphosphoryl-2,2-difluoroacetyl)pyrrol-2-yl]butanedioate.
| Compound Name | dibenzyl 2-[2-(2-diethoxyphosphoryl-2,2-difluoroacetyl)pyrrol-2-yl]butanedioate |
|---|---|
| PubChem CID | 57029636 |
| Molecular Formula | C28H30F2NO8P |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | dibenzyl 2-[2-(2-diethoxyphosphoryl-2,2-difluoroacetyl)pyrrol-2-yl]butanedioate |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(=O)C1(C(CC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)C=CC=N1 |
| InChI | InChI=1S/C28H30F2NO8P/c1-3-38-40(35,39-4-2)28(29,30)26(34)27(16-11-17-31-27)23(25(33)37-20-22-14-9-6-10-15-22)18-24(32)36-19-21-12-7-5-8-13-21/h5-17,23H,3-4,18-20H2,1-2H3 |
| InChIKey | IGHAGYBYXJOGRO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 117.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|