C30H33BrN2O6 — CID 90822156
benzyl 5-bromo-5-(2-butanoylpyrrol-2-yl)-3-methyl-4-oxo-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoate (PubChem CID 90822156) has the molecular formula C30H33BrN2O6 and a molecular weight of 597.51 g/mol. Its IUPAC name is benzyl 5-bromo-5-(2-butanoylpyrrol-2-yl)-3-methyl-4-oxo-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoate.
| Compound Name | benzyl 5-bromo-5-(2-butanoylpyrrol-2-yl)-3-methyl-4-oxo-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoate |
|---|---|
| PubChem CID | 90822156 |
| Molecular Formula | C30H33BrN2O6 |
| Molecular Weight | 597.51 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | benzyl 5-bromo-5-(2-butanoylpyrrol-2-yl)-3-methyl-4-oxo-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoate |
| SMILES | CCCC(=O)C1(C(Br)C(=O)C(C)C(CC(=O)NOCc2ccccc2)C(=O)OCc2ccccc2)C=CC=N1 |
| InChI | InChI=1S/C30H33BrN2O6/c1-3-11-25(34)30(16-10-17-32-30)28(31)27(36)21(2)24(29(37)38-19-22-12-6-4-7-13-22)18-26(35)33-39-20-23-14-8-5-9-15-23/h4-10,12-17,21,24,28H,3,11,18-20H2,1-2H3,(H,33,35) |
| InChIKey | PLFYBEKZCNCNHG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|