About 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate
4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate (PubChem CID 58153516) has the molecular formula C18H27O7P
and a molecular weight of 386.38 g/mol. Its IUPAC name is 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate.
Molecular Properties
| Compound Name | 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate |
| PubChem CID | 58153516 |
| Molecular Formula | C18H27O7P |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate |
| SMILES | CCOP(=O)(CC[C@@H](CC(=O)OCc1ccccc1)C(=O)OC)OCC |
| InChI | InChI=1S/C18H27O7P/c1-4-24-26(21,25-5-2)12-11-16(18(20)22-3)13-17(19)23-14-15-9-7-6-8-10-15/h6-10,16H,4-5,11-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | QPQSFHRRMPMUJQ-INIZCTEOSA-N |
| XLogP | 3.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate?
The IUPAC name of 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate (CID 58153516) is 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate.
What is the SMILES notation for 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate?
The canonical SMILES for 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate is CCOP(=O)(CC[C@@H](CC(=O)OCc1ccccc1)C(=O)OC)OCC.
What is the InChIKey of 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate?
The InChIKey is QPQSFHRRMPMUJQ-INIZCTEOSA-N. The full InChI is InChI=1S/C18H27O7P/c1-4-24-26(21,25-5-2)12-11-16(18(20)22-3)13-17(19)23-14-15-9-7-6-8-10-15/h6-10,16H,4-5,11-14H2,1-3H3/t16-/m0/s1.
What are the key properties of 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate?
4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate has a molecular weight of 386.38 g/mol, XLogP of 3.57, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-benzyl 1-O-methyl (2R)-2-(2-diethoxyphosphorylethyl)butanedioate is sourced from PubChem (CID 58153516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).