C17H27N2O7P — CID 156666995
3-(2-diethoxyphosphorylethylamino)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 156666995) has the molecular formula C17H27N2O7P and a molecular weight of 402.38 g/mol. Its IUPAC name is 3-(2-diethoxyphosphorylethylamino)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(2-diethoxyphosphorylethylamino)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 156666995 |
| Molecular Formula | C17H27N2O7P |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3-(2-diethoxyphosphorylethylamino)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CCOP(=O)(CCNCC(NC(=O)OCc1ccccc1)C(=O)O)OCC |
| InChI | InChI=1S/C17H27N2O7P/c1-3-25-27(23,26-4-2)11-10-18-12-15(16(20)21)19-17(22)24-13-14-8-6-5-7-9-14/h5-9,15,18H,3-4,10-13H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | RGXXMFYFKCODSI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|