C15H20N2O6 — CID 174501660
2-(methylaminomethyl)-4-(phenylmethoxycarbonylamino)pentanedioic acid (PubChem CID 174501660) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-(methylaminomethyl)-4-(phenylmethoxycarbonylamino)pentanedioic acid.
| Compound Name | 2-(methylaminomethyl)-4-(phenylmethoxycarbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 174501660 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(methylaminomethyl)-4-(phenylmethoxycarbonylamino)pentanedioic acid |
| SMILES | CNCC(CC(NC(=O)OCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H20N2O6/c1-16-8-11(13(18)19)7-12(14(20)21)17-15(22)23-9-10-5-3-2-4-6-10/h2-6,11-12,16H,7-9H2,1H3,(H,17,22)(H,18,19)(H,20,21) |
| InChIKey | QDISINAGMLZXRR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |