C21H34NO7P — CID 118520617
methyl 6-[2-diethoxyphosphorylethyl(phenylmethoxycarbonyl)amino]hexanoate (PubChem CID 118520617) has the molecular formula C21H34NO7P and a molecular weight of 443.48 g/mol. Its IUPAC name is methyl 6-[2-diethoxyphosphorylethyl(phenylmethoxycarbonyl)amino]hexanoate.
| Compound Name | methyl 6-[2-diethoxyphosphorylethyl(phenylmethoxycarbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 118520617 |
| Molecular Formula | C21H34NO7P |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | methyl 6-[2-diethoxyphosphorylethyl(phenylmethoxycarbonyl)amino]hexanoate |
| SMILES | CCOP(=O)(CCN(CCCCCC(=O)OC)C(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C21H34NO7P/c1-4-28-30(25,29-5-2)17-16-22(15-11-7-10-14-20(23)26-3)21(24)27-18-19-12-8-6-9-13-19/h6,8-9,12-13H,4-5,7,10-11,14-18H2,1-3H3 |
| InChIKey | JHKWWOZNPVWEQJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|