C24H30N2O4 — CID 59687104
methyl 6-[benzoylcarbamoyl(3-phenylpropyl)amino]hexanoate (PubChem CID 59687104) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is methyl 6-[benzoylcarbamoyl(3-phenylpropyl)amino]hexanoate.
| Compound Name | methyl 6-[benzoylcarbamoyl(3-phenylpropyl)amino]hexanoate |
|---|---|
| PubChem CID | 59687104 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | methyl 6-[benzoylcarbamoyl(3-phenylpropyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCN(CCCc1ccccc1)C(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O4/c1-30-22(27)17-9-4-10-18-26(19-11-14-20-12-5-2-6-13-20)24(29)25-23(28)21-15-7-3-8-16-21/h2-3,5-8,12-13,15-16H,4,9-11,14,17-19H2,1H3,(H,25,28,29) |
| InChIKey | SVXNYYGLTHDHOA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|