C24H30FNO5 — CID 131988415
methyl 5-[(4-fluoro-3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]pentanoate (PubChem CID 131988415) has the molecular formula C24H30FNO5 and a molecular weight of 431.50 g/mol. Its IUPAC name is methyl 5-[(4-fluoro-3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]pentanoate.
| Compound Name | methyl 5-[(4-fluoro-3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]pentanoate |
|---|---|
| PubChem CID | 131988415 |
| Molecular Formula | C24H30FNO5 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | methyl 5-[(4-fluoro-3,5-dimethoxybenzoyl)-(3-phenylpropyl)amino]pentanoate |
| SMILES | COC(=O)CCCCN(CCCc1ccccc1)C(=O)c1cc(OC)c(F)c(OC)c1 |
| InChI | InChI=1S/C24H30FNO5/c1-29-20-16-19(17-21(30-2)23(20)25)24(28)26(14-8-7-13-22(27)31-3)15-9-12-18-10-5-4-6-11-18/h4-6,10-11,16-17H,7-9,12-15H2,1-3H3 |
| InChIKey | JNFVSWITARKDJV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|