C29H35N3O6S — CID 131988304
3,5-dimethoxy-4-methyl-N-[5-oxo-5-(pyridin-2-ylsulfonylamino)pentyl]-N-(3-phenylpropyl)benzamide (PubChem CID 131988304) has the molecular formula C29H35N3O6S and a molecular weight of 553.68 g/mol. Its IUPAC name is 3,5-dimethoxy-4-methyl-N-[5-oxo-5-(pyridin-2-ylsulfonylamino)pentyl]-N-(3-phenylpropyl)benzamide.
| Compound Name | 3,5-dimethoxy-4-methyl-N-[5-oxo-5-(pyridin-2-ylsulfonylamino)pentyl]-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 131988304 |
| Molecular Formula | C29H35N3O6S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 3,5-dimethoxy-4-methyl-N-[5-oxo-5-(pyridin-2-ylsulfonylamino)pentyl]-N-(3-phenylpropyl)benzamide |
| SMILES | COc1cc(C(=O)N(CCCCC(=O)NS(=O)(=O)c2ccccn2)CCCc2ccccc2)cc(OC)c1C |
| InChI | InChI=1S/C29H35N3O6S/c1-22-25(37-2)20-24(21-26(22)38-3)29(34)32(19-11-14-23-12-5-4-6-13-23)18-10-8-15-27(33)31-39(35,36)28-16-7-9-17-30-28/h4-7,9,12-13,16-17,20-21H,8,10-11,14-15,18-19H2,1-3H3,(H,31,33) |
| InChIKey | NMBFOGZWVFKGHB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|