C22H26FNO4 — CID 131988227
5-[(4-fluoro-3-methoxybenzoyl)-(3-phenylpropyl)amino]pentanoic acid (PubChem CID 131988227) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is 5-[(4-fluoro-3-methoxybenzoyl)-(3-phenylpropyl)amino]pentanoic acid.
| Compound Name | 5-[(4-fluoro-3-methoxybenzoyl)-(3-phenylpropyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 131988227 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 5-[(4-fluoro-3-methoxybenzoyl)-(3-phenylpropyl)amino]pentanoic acid |
| SMILES | COc1cc(C(=O)N(CCCCC(=O)O)CCCc2ccccc2)ccc1F |
| InChI | InChI=1S/C22H26FNO4/c1-28-20-16-18(12-13-19(20)23)22(27)24(14-6-5-11-21(25)26)15-7-10-17-8-3-2-4-9-17/h2-4,8-9,12-13,16H,5-7,10-11,14-15H2,1H3,(H,25,26) |
| InChIKey | RTBQSCZORKYSJA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|