C26H35NO7 — CID 138559061
methyl 5-[[4-(2-hydroxyethoxy)-3,5-dimethoxybenzoyl]-(3-phenylpropyl)amino]pentanoate (PubChem CID 138559061) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is methyl 5-[[4-(2-hydroxyethoxy)-3,5-dimethoxybenzoyl]-(3-phenylpropyl)amino]pentanoate.
| Compound Name | methyl 5-[[4-(2-hydroxyethoxy)-3,5-dimethoxybenzoyl]-(3-phenylpropyl)amino]pentanoate |
|---|---|
| PubChem CID | 138559061 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | methyl 5-[[4-(2-hydroxyethoxy)-3,5-dimethoxybenzoyl]-(3-phenylpropyl)amino]pentanoate |
| SMILES | COC(=O)CCCCN(CCCc1ccccc1)C(=O)c1cc(OC)c(OCCO)c(OC)c1 |
| InChI | InChI=1S/C26H35NO7/c1-31-22-18-21(19-23(32-2)25(22)34-17-16-28)26(30)27(14-8-7-13-24(29)33-3)15-9-12-20-10-5-4-6-11-20/h4-6,10-11,18-19,28H,7-9,12-17H2,1-3H3 |
| InChIKey | ODGOCMVGJIBAPC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|